C26H45N3O — CID 143254253
ethane;[4-(4-methylcyclohexyl)piperazin-1-yl]-[4-methyl-3-(propan-2-ylideneamino)phenyl]methanone (PubChem CID 143254253) has the molecular formula C26H45N3O and a molecular weight of 415.67 g/mol. Its IUPAC name is ethane;[4-(4-methylcyclohexyl)piperazin-1-yl]-[4-methyl-3-(propan-2-ylideneamino)phenyl]methanone.
| Compound Name | ethane;[4-(4-methylcyclohexyl)piperazin-1-yl]-[4-methyl-3-(propan-2-ylideneamino)phenyl]methanone |
|---|---|
| PubChem CID | 143254253 |
| Molecular Formula | C26H45N3O |
| Molecular Weight | 415.67 g/mol |
| Exact Mass | 415.36 |
| IUPAC Name | ethane;[4-(4-methylcyclohexyl)piperazin-1-yl]-[4-methyl-3-(propan-2-ylideneamino)phenyl]methanone |
| SMILES | CC.CC.CC(C)=Nc1cc(C(=O)N2CCN(C3CCC(C)CC3)CC2)ccc1C |
| InChI | InChI=1S/C22H33N3O.2C2H6/c1-16(2)23-21-15-19(8-7-18(21)4)22(26)25-13-11-24(12-14-25)20-9-5-17(3)6-10-20;2*1-2/h7-8,15,17,20H,5-6,9-14H2,1-4H3;2*1-2H3 |
| InChIKey | WJDJGMZJWXSJFG-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.67 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|