C26H28F2N6O2 — CID 143254272
1-[5-[[2-(cyclopropen-1-ylmethyl)-4-(morpholin-4-ylmethyl)anilino]methyl]-1H-pyrazol-4-yl]-3-(3,4-difluorophenyl)urea (PubChem CID 143254272) has the molecular formula C26H28F2N6O2 and a molecular weight of 494.55 g/mol. Its IUPAC name is 1-[5-[[2-(cyclopropen-1-ylmethyl)-4-(morpholin-4-ylmethyl)anilino]methyl]-1H-pyrazol-4-yl]-3-(3,4-difluorophenyl)urea.
| Compound Name | 1-[5-[[2-(cyclopropen-1-ylmethyl)-4-(morpholin-4-ylmethyl)anilino]methyl]-1H-pyrazol-4-yl]-3-(3,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 143254272 |
| Molecular Formula | C26H28F2N6O2 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | 1-[5-[[2-(cyclopropen-1-ylmethyl)-4-(morpholin-4-ylmethyl)anilino]methyl]-1H-pyrazol-4-yl]-3-(3,4-difluorophenyl)urea |
| SMILES | O=C(Nc1ccc(F)c(F)c1)Nc1cn[nH]c1CNc1ccc(CN2CCOCC2)cc1CC1=CC1 |
| InChI | InChI=1S/C26H28F2N6O2/c27-21-5-4-20(13-22(21)28)31-26(35)32-24-15-30-33-25(24)14-29-23-6-3-18(12-19(23)11-17-1-2-17)16-34-7-9-36-10-8-34/h1,3-6,12-13,15,29H,2,7-11,14,16H2,(H,30,33)(H2,31,32,35) |
| InChIKey | FRUIPCRDPXVCHK-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|