About N-(3-acetyl-1-methylcyclohexa-2,4-dien-1-yl)acetamide
N-(3-acetyl-1-methylcyclohexa-2,4-dien-1-yl)acetamide (PubChem CID 143254316) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is N-(3-acetyl-1-methylcyclohexa-2,4-dien-1-yl)acetamide.
Molecular Properties
| Compound Name | N-(3-acetyl-1-methylcyclohexa-2,4-dien-1-yl)acetamide |
| PubChem CID | 143254316 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | N-(3-acetyl-1-methylcyclohexa-2,4-dien-1-yl)acetamide |
| SMILES | CC(=O)NC1(C)C=C(C(C)=O)C=CC1 |
| InChI | InChI=1S/C11H15NO2/c1-8(13)10-5-4-6-11(3,7-10)12-9(2)14/h4-5,7H,6H2,1-3H3,(H,12,14) |
| InChIKey | DVSWQTOXBGGZSF-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(3-acetyl-1-methylcyclohexa-2,4-dien-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-acetyl-1-methylcyclohexa-2,4-dien-1-yl)acetamide?
The IUPAC name of N-(3-acetyl-1-methylcyclohexa-2,4-dien-1-yl)acetamide (CID 143254316) is N-(3-acetyl-1-methylcyclohexa-2,4-dien-1-yl)acetamide.
What is the SMILES notation for N-(3-acetyl-1-methylcyclohexa-2,4-dien-1-yl)acetamide?
The canonical SMILES for N-(3-acetyl-1-methylcyclohexa-2,4-dien-1-yl)acetamide is CC(=O)NC1(C)C=C(C(C)=O)C=CC1.
What is the InChIKey of N-(3-acetyl-1-methylcyclohexa-2,4-dien-1-yl)acetamide?
The InChIKey is DVSWQTOXBGGZSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2/c1-8(13)10-5-4-6-11(3,7-10)12-9(2)14/h4-5,7H,6H2,1-3H3,(H,12,14).
What are the key properties of N-(3-acetyl-1-methylcyclohexa-2,4-dien-1-yl)acetamide?
N-(3-acetyl-1-methylcyclohexa-2,4-dien-1-yl)acetamide has a molecular weight of 193.25 g/mol, XLogP of 1.36, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-acetyl-1-methylcyclohexa-2,4-dien-1-yl)acetamide is sourced from PubChem (CID 143254316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).