About 2-(2-cyclopentylethyl)-2-heptyl-1,3-dioxane;(Z)-hept-5-enoic acid
2-(2-cyclopentylethyl)-2-heptyl-1,3-dioxane;(Z)-hept-5-enoic acid (PubChem CID 143254979) has the molecular formula C25H46O4
and a molecular weight of 410.64 g/mol. Its IUPAC name is 2-(2-cyclopentylethyl)-2-heptyl-1,3-dioxane;(Z)-hept-5-enoic acid.
Molecular Properties
| Compound Name | 2-(2-cyclopentylethyl)-2-heptyl-1,3-dioxane;(Z)-hept-5-enoic acid |
| PubChem CID | 143254979 |
| Molecular Formula | C25H46O4 |
| Molecular Weight | 410.64 g/mol |
| Exact Mass | 410.34 |
| IUPAC Name | 2-(2-cyclopentylethyl)-2-heptyl-1,3-dioxane;(Z)-hept-5-enoic acid |
| SMILES | C/C=C\CCCC(=O)O.CCCCCCCC1(CCC2CCCC2)OCCCO1 |
| InChI | InChI=1S/C18H34O2.C7H12O2/c1-2-3-4-5-8-13-18(19-15-9-16-20-18)14-12-17-10-6-7-11-17;1-2-3-4-5-6-7(8)9/h17H,2-16H2,1H3;2-3H,4-6H2,1H3,(H,8,9)/b;3-2- |
| InChIKey | FHSPNZVLMBJUBR-AHNKWOMYSA-N |
| XLogP | 7.27 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.64 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-cyclopentylethyl)-2-heptyl-1,3-dioxane;(Z)-hept-5-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-cyclopentylethyl)-2-heptyl-1,3-dioxane;(Z)-hept-5-enoic acid?
The IUPAC name of 2-(2-cyclopentylethyl)-2-heptyl-1,3-dioxane;(Z)-hept-5-enoic acid (CID 143254979) is 2-(2-cyclopentylethyl)-2-heptyl-1,3-dioxane;(Z)-hept-5-enoic acid.
What is the SMILES notation for 2-(2-cyclopentylethyl)-2-heptyl-1,3-dioxane;(Z)-hept-5-enoic acid?
The canonical SMILES for 2-(2-cyclopentylethyl)-2-heptyl-1,3-dioxane;(Z)-hept-5-enoic acid is C/C=C\CCCC(=O)O.CCCCCCCC1(CCC2CCCC2)OCCCO1.
What is the InChIKey of 2-(2-cyclopentylethyl)-2-heptyl-1,3-dioxane;(Z)-hept-5-enoic acid?
The InChIKey is FHSPNZVLMBJUBR-AHNKWOMYSA-N. The full InChI is InChI=1S/C18H34O2.C7H12O2/c1-2-3-4-5-8-13-18(19-15-9-16-20-18)14-12-17-10-6-7-11-17;1-2-3-4-5-6-7(8)9/h17H,2-16H2,1H3;2-3H,4-6H2,1H3,(H,8,9)/b;3-2-.
What are the key properties of 2-(2-cyclopentylethyl)-2-heptyl-1,3-dioxane;(Z)-hept-5-enoic acid?
2-(2-cyclopentylethyl)-2-heptyl-1,3-dioxane;(Z)-hept-5-enoic acid has a molecular weight of 410.64 g/mol, XLogP of 7.27, 13 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-cyclopentylethyl)-2-heptyl-1,3-dioxane;(Z)-hept-5-enoic acid is sourced from PubChem (CID 143254979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).