C19H18FN5O — CID 143255018
4-[4-(4-fluoro-3-methylphenyl)-2-[(E)-3-imino-1-methoxyprop-1-enyl]-1H-imidazol-5-yl]pyridin-2-amine (PubChem CID 143255018) has the molecular formula C19H18FN5O and a molecular weight of 351.39 g/mol. Its IUPAC name is 4-[4-(4-fluoro-3-methylphenyl)-2-[(E)-3-imino-1-methoxyprop-1-enyl]-1H-imidazol-5-yl]pyridin-2-amine.
| Compound Name | 4-[4-(4-fluoro-3-methylphenyl)-2-[(E)-3-imino-1-methoxyprop-1-enyl]-1H-imidazol-5-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 143255018 |
| Molecular Formula | C19H18FN5O |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 4-[4-(4-fluoro-3-methylphenyl)-2-[(E)-3-imino-1-methoxyprop-1-enyl]-1H-imidazol-5-yl]pyridin-2-amine |
| SMILES | [H]/N=C/C=C(/OC)c1nc(-c2ccc(F)c(C)c2)c(-c2ccnc(N)c2)[nH]1 |
| InChI | InChI=1S/C19H18FN5O/c1-11-9-12(3-4-14(11)20)17-18(13-6-8-23-16(22)10-13)25-19(24-17)15(26-2)5-7-21/h3-10,21H,1-2H3,(H2,22,23)(H,24,25)/b15-5+,21-7+ |
| InChIKey | UCLRREYAEFFOPT-IPWLJVKKSA-N |
| XLogP | 3.81 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|