About ethane;6-methanimidoyl-3-methylcyclohexa-1,5-dien-1-amine
ethane;6-methanimidoyl-3-methylcyclohexa-1,5-dien-1-amine (PubChem CID 143255293) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is ethane;6-methanimidoyl-3-methylcyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | ethane;6-methanimidoyl-3-methylcyclohexa-1,5-dien-1-amine |
| PubChem CID | 143255293 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | ethane;6-methanimidoyl-3-methylcyclohexa-1,5-dien-1-amine |
| SMILES | CC.[H]/N=C/C1=CCC(C)C=C1N |
| InChI | InChI=1S/C8H12N2.C2H6/c1-6-2-3-7(5-9)8(10)4-6;1-2/h3-6,9H,2,10H2,1H3;1-2H3/b9-5+; |
| InChIKey | UIYSUUUGHPDBMB-SZKNIZGXSA-N |
| XLogP | 2.47 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;6-methanimidoyl-3-methylcyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6-methanimidoyl-3-methylcyclohexa-1,5-dien-1-amine?
The IUPAC name of ethane;6-methanimidoyl-3-methylcyclohexa-1,5-dien-1-amine (CID 143255293) is ethane;6-methanimidoyl-3-methylcyclohexa-1,5-dien-1-amine.
What is the SMILES notation for ethane;6-methanimidoyl-3-methylcyclohexa-1,5-dien-1-amine?
The canonical SMILES for ethane;6-methanimidoyl-3-methylcyclohexa-1,5-dien-1-amine is CC.[H]/N=C/C1=CCC(C)C=C1N.
What is the InChIKey of ethane;6-methanimidoyl-3-methylcyclohexa-1,5-dien-1-amine?
The InChIKey is UIYSUUUGHPDBMB-SZKNIZGXSA-N. The full InChI is InChI=1S/C8H12N2.C2H6/c1-6-2-3-7(5-9)8(10)4-6;1-2/h3-6,9H,2,10H2,1H3;1-2H3/b9-5+;.
What are the key properties of ethane;6-methanimidoyl-3-methylcyclohexa-1,5-dien-1-amine?
ethane;6-methanimidoyl-3-methylcyclohexa-1,5-dien-1-amine has a molecular weight of 166.27 g/mol, XLogP of 2.47, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6-methanimidoyl-3-methylcyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 143255293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).