C22H26ClN5 — CID 143256047
2-[(3S)-3-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]pyrrolidin-1-yl]-1H-benzimidazole (PubChem CID 143256047) has the molecular formula C22H26ClN5 and a molecular weight of 395.94 g/mol. Its IUPAC name is 2-[(3S)-3-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]pyrrolidin-1-yl]-1H-benzimidazole.
| Compound Name | 2-[(3S)-3-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]pyrrolidin-1-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 143256047 |
| Molecular Formula | C22H26ClN5 |
| Molecular Weight | 395.94 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 2-[(3S)-3-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]pyrrolidin-1-yl]-1H-benzimidazole |
| SMILES | Clc1ccc(CN2CCN([C@H]3CCN(c4nc5ccccc5[nH]4)C3)CC2)cc1 |
| InChI | InChI=1S/C22H26ClN5/c23-18-7-5-17(6-8-18)15-26-11-13-27(14-12-26)19-9-10-28(16-19)22-24-20-3-1-2-4-21(20)25-22/h1-8,19H,9-16H2,(H,24,25)/t19-/m0/s1 |
| InChIKey | YZWMGNBODVJIRD-IBGZPJMESA-N |
| XLogP | 3.61 |
| TPSA | 38.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.94 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |