About 2-Amino-1,4-butanediol
2-Amino-1,4-butanediol (PubChem CID 14325613) has the molecular formula C4H11NO2
and a molecular weight of 105.14 g/mol. Its IUPAC name is 2-aminobutane-1,4-diol.
Molecular Properties
| Compound Name | 2-Amino-1,4-butanediol |
| PubChem CID | 14325613 |
| Molecular Formula | C4H11NO2 |
| Molecular Weight | 105.14 g/mol |
| Exact Mass | 105.08 |
| IUPAC Name | 2-aminobutane-1,4-diol |
| SMILES | C(CO)C(CO)N |
| InChI | InChI=1S/C4H11NO2/c5-4(3-7)1-2-6/h4,6-7H,1-3,5H2 |
| InChIKey | PYBVXNWDSBYQSA-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 66.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | 40 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 105.14 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-Amino-1,4-butanediol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-Amino-1,4-butanediol?
The IUPAC name of 2-Amino-1,4-butanediol (CID 14325613) is 2-aminobutane-1,4-diol.
What is the SMILES notation for 2-Amino-1,4-butanediol?
The canonical SMILES for 2-Amino-1,4-butanediol is C(CO)C(CO)N.
What is the InChIKey of 2-Amino-1,4-butanediol?
The InChIKey is PYBVXNWDSBYQSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11NO2/c5-4(3-7)1-2-6/h4,6-7H,1-3,5H2.
What are the key properties of 2-Amino-1,4-butanediol?
2-Amino-1,4-butanediol has a molecular weight of 105.14 g/mol, XLogP of -1.70, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-Amino-1,4-butanediol is sourced from PubChem (CID 14325613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).