C33H39N7O4 — CID 143256186
6-[3-butyl-5-[1-(3-pyridin-3-yloxyanilino)ethenylamino]pyrazol-1-yl]-N-(2,3-dihydroxypropyl)-1,2,3,4-tetrahydroisoquinoline-1-carboxamide (PubChem CID 143256186) has the molecular formula C33H39N7O4 and a molecular weight of 597.72 g/mol. Its IUPAC name is 6-[3-butyl-5-[1-(3-pyridin-3-yloxyanilino)ethenylamino]pyrazol-1-yl]-N-(2,3-dihydroxypropyl)-1,2,3,4-tetrahydroisoquinoline-1-carboxamide.
| Compound Name | 6-[3-butyl-5-[1-(3-pyridin-3-yloxyanilino)ethenylamino]pyrazol-1-yl]-N-(2,3-dihydroxypropyl)-1,2,3,4-tetrahydroisoquinoline-1-carboxamide |
|---|---|
| PubChem CID | 143256186 |
| Molecular Formula | C33H39N7O4 |
| Molecular Weight | 597.72 g/mol |
| Exact Mass | 597.31 |
| IUPAC Name | 6-[3-butyl-5-[1-(3-pyridin-3-yloxyanilino)ethenylamino]pyrazol-1-yl]-N-(2,3-dihydroxypropyl)-1,2,3,4-tetrahydroisoquinoline-1-carboxamide |
| SMILES | C=C(Nc1cccc(Oc2cccnc2)c1)Nc1cc(CCCC)nn1-c1ccc2c(c1)CCNC2C(=O)NCC(O)CO |
| InChI | InChI=1S/C33H39N7O4/c1-3-4-7-25-18-31(38-22(2)37-24-8-5-9-28(17-24)44-29-10-6-14-34-20-29)40(39-25)26-11-12-30-23(16-26)13-15-35-32(30)33(43)36-19-27(42)21-41/h5-6,8-12,14,16-18,20,27,32,35,37-38,41-42H,2-4,7,13,15,19,21H2,1H3,(H,36,43) |
| InChIKey | PICDPIWTJXIYOQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 145.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.72 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |