About ethane;N-[(3E)-2-methoxy-5-methylhexa-1,3,5-trien-3-yl]methanimine
ethane;N-[(3E)-2-methoxy-5-methylhexa-1,3,5-trien-3-yl]methanimine (PubChem CID 143256194) has the molecular formula C13H25NO
and a molecular weight of 211.35 g/mol. Its IUPAC name is ethane;N-[(3E)-2-methoxy-5-methylhexa-1,3,5-trien-3-yl]methanimine.
Molecular Properties
| Compound Name | ethane;N-[(3E)-2-methoxy-5-methylhexa-1,3,5-trien-3-yl]methanimine |
| PubChem CID | 143256194 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | ethane;N-[(3E)-2-methoxy-5-methylhexa-1,3,5-trien-3-yl]methanimine |
| SMILES | C=N/C(=C/C(=C)C)C(=C)OC.CC.CC |
| InChI | InChI=1S/C9H13NO.2C2H6/c1-7(2)6-9(10-4)8(3)11-5;2*1-2/h6H,1,3-4H2,2,5H3;2*1-2H3/b9-6+;; |
| InChIKey | AKJCWRMCAWXEDF-SWSRPJROSA-N |
| XLogP | 4.36 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-[(3E)-2-methoxy-5-methylhexa-1,3,5-trien-3-yl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-[(3E)-2-methoxy-5-methylhexa-1,3,5-trien-3-yl]methanimine?
The IUPAC name of ethane;N-[(3E)-2-methoxy-5-methylhexa-1,3,5-trien-3-yl]methanimine (CID 143256194) is ethane;N-[(3E)-2-methoxy-5-methylhexa-1,3,5-trien-3-yl]methanimine.
What is the SMILES notation for ethane;N-[(3E)-2-methoxy-5-methylhexa-1,3,5-trien-3-yl]methanimine?
The canonical SMILES for ethane;N-[(3E)-2-methoxy-5-methylhexa-1,3,5-trien-3-yl]methanimine is C=N/C(=C/C(=C)C)C(=C)OC.CC.CC.
What is the InChIKey of ethane;N-[(3E)-2-methoxy-5-methylhexa-1,3,5-trien-3-yl]methanimine?
The InChIKey is AKJCWRMCAWXEDF-SWSRPJROSA-N. The full InChI is InChI=1S/C9H13NO.2C2H6/c1-7(2)6-9(10-4)8(3)11-5;2*1-2/h6H,1,3-4H2,2,5H3;2*1-2H3/b9-6+;;.
What are the key properties of ethane;N-[(3E)-2-methoxy-5-methylhexa-1,3,5-trien-3-yl]methanimine?
ethane;N-[(3E)-2-methoxy-5-methylhexa-1,3,5-trien-3-yl]methanimine has a molecular weight of 211.35 g/mol, XLogP of 4.36, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-[(3E)-2-methoxy-5-methylhexa-1,3,5-trien-3-yl]methanimine is sourced from PubChem (CID 143256194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).