C14H27NO — CID 143256253
ethane;N-[(3E,5Z)-3-methoxy-5-methylhepta-1,3,5-trien-2-yl]methanimine (PubChem CID 143256253) has the molecular formula C14H27NO and a molecular weight of 225.38 g/mol. Its IUPAC name is ethane;N-[(3E,5Z)-3-methoxy-5-methylhepta-1,3,5-trien-2-yl]methanimine.
| Compound Name | ethane;N-[(3E,5Z)-3-methoxy-5-methylhepta-1,3,5-trien-2-yl]methanimine |
|---|---|
| PubChem CID | 143256253 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | ethane;N-[(3E,5Z)-3-methoxy-5-methylhepta-1,3,5-trien-2-yl]methanimine |
| SMILES | C=NC(=C)/C(=C/C(C)=C\C)OC.CC.CC |
| InChI | InChI=1S/C10H15NO.2C2H6/c1-6-8(2)7-10(12-5)9(3)11-4;2*1-2/h6-7H,3-4H2,1-2,5H3;2*1-2H3/b8-6-,10-7+;; |
| InChIKey | DVCBGXNCBDLOTL-UDTBOVSNSA-N |
| XLogP | 4.75 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|