C14H25NO — CID 143256282
ethane;N-[(2E,4E,6Z)-4-methoxy-6-methylnona-2,4,6-trien-3-yl]methanimine (PubChem CID 143256282) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is ethane;N-[(2E,4E,6Z)-4-methoxy-6-methylnona-2,4,6-trien-3-yl]methanimine.
| Compound Name | ethane;N-[(2E,4E,6Z)-4-methoxy-6-methylnona-2,4,6-trien-3-yl]methanimine |
|---|---|
| PubChem CID | 143256282 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | ethane;N-[(2E,4E,6Z)-4-methoxy-6-methylnona-2,4,6-trien-3-yl]methanimine |
| SMILES | C=NC(=C/C)/C(=C\C(C)=C/CC)OC.CC |
| InChI | InChI=1S/C12H19NO.C2H6/c1-6-8-10(3)9-12(14-5)11(7-2)13-4;1-2/h7-9H,4,6H2,1-3,5H3;1-2H3/b10-8-,11-7+,12-9+; |
| InChIKey | BZTHZKHVNDEDRP-USPCXQMTSA-N |
| XLogP | 4.50 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|