About (1Z,3E)-1-aminopenta-1,3-dien-3-ol;ethane
(1Z,3E)-1-aminopenta-1,3-dien-3-ol;ethane (PubChem CID 143256321) has the molecular formula C7H15NO
and a molecular weight of 129.20 g/mol. Its IUPAC name is (1Z,3E)-1-aminopenta-1,3-dien-3-ol;ethane.
Molecular Properties
| Compound Name | (1Z,3E)-1-aminopenta-1,3-dien-3-ol;ethane |
| PubChem CID | 143256321 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | (1Z,3E)-1-aminopenta-1,3-dien-3-ol;ethane |
| SMILES | C/C=C(O)\C=C/N.CC |
| InChI | InChI=1S/C5H9NO.C2H6/c1-2-5(7)3-4-6;1-2/h2-4,7H,6H2,1H3;1-2H3/b4-3-,5-2+; |
| InChIKey | YSPPZAVUHQNKQC-JIPJKINWSA-N |
| XLogP | 1.95 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1Z,3E)-1-aminopenta-1,3-dien-3-ol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z,3E)-1-aminopenta-1,3-dien-3-ol;ethane?
The IUPAC name of (1Z,3E)-1-aminopenta-1,3-dien-3-ol;ethane (CID 143256321) is (1Z,3E)-1-aminopenta-1,3-dien-3-ol;ethane.
What is the SMILES notation for (1Z,3E)-1-aminopenta-1,3-dien-3-ol;ethane?
The canonical SMILES for (1Z,3E)-1-aminopenta-1,3-dien-3-ol;ethane is C/C=C(O)\C=C/N.CC.
What is the InChIKey of (1Z,3E)-1-aminopenta-1,3-dien-3-ol;ethane?
The InChIKey is YSPPZAVUHQNKQC-JIPJKINWSA-N. The full InChI is InChI=1S/C5H9NO.C2H6/c1-2-5(7)3-4-6;1-2/h2-4,7H,6H2,1H3;1-2H3/b4-3-,5-2+;.
What are the key properties of (1Z,3E)-1-aminopenta-1,3-dien-3-ol;ethane?
(1Z,3E)-1-aminopenta-1,3-dien-3-ol;ethane has a molecular weight of 129.20 g/mol, XLogP of 1.95, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z,3E)-1-aminopenta-1,3-dien-3-ol;ethane is sourced from PubChem (CID 143256321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).