C13H27NO — CID 143256404
ethane;(3E,5Z)-2-methoxy-5-methylhepta-1,3,5-trien-3-amine (PubChem CID 143256404) has the molecular formula C13H27NO and a molecular weight of 213.36 g/mol. Its IUPAC name is ethane;(3E,5Z)-2-methoxy-5-methylhepta-1,3,5-trien-3-amine.
| Compound Name | ethane;(3E,5Z)-2-methoxy-5-methylhepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 143256404 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | ethane;(3E,5Z)-2-methoxy-5-methylhepta-1,3,5-trien-3-amine |
| SMILES | C=C(OC)/C(N)=C\C(C)=C/C.CC.CC |
| InChI | InChI=1S/C9H15NO.2C2H6/c1-5-7(2)6-9(10)8(3)11-4;2*1-2/h5-6H,3,10H2,1-2,4H3;2*1-2H3/b7-5-,9-6+;; |
| InChIKey | FTBSASDCYBSZDJ-GZFYBLGYSA-N |
| XLogP | 4.01 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|