About (1Z,3E)-3-hydrazinylpenta-1,3-dien-1-amine;methylthallium
(1Z,3E)-3-hydrazinylpenta-1,3-dien-1-amine;methylthallium (PubChem CID 143256524) has the molecular formula C6H14N3Tl
and a molecular weight of 332.58 g/mol. Its IUPAC name is (1Z,3E)-3-hydrazinylpenta-1,3-dien-1-amine;methylthallium.
Molecular Properties
| Compound Name | (1Z,3E)-3-hydrazinylpenta-1,3-dien-1-amine;methylthallium |
| PubChem CID | 143256524 |
| Molecular Formula | C6H14N3Tl |
| Molecular Weight | 332.58 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | (1Z,3E)-3-hydrazinylpenta-1,3-dien-1-amine;methylthallium |
| SMILES | C/C=C(\C=C/N)NN.C[Tl] |
| InChI | InChI=1S/C5H11N3.CH3.Tl/c1-2-5(8-7)3-4-6;;/h2-4,8H,6-7H2,1H3;1H3;/b4-3-,5-2+;; |
| InChIKey | IFZDRQVGEUNYBD-MUGVSWDDSA-N |
| XLogP | 0.03 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.58 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1Z,3E)-3-hydrazinylpenta-1,3-dien-1-amine;methylthallium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z,3E)-3-hydrazinylpenta-1,3-dien-1-amine;methylthallium?
The IUPAC name of (1Z,3E)-3-hydrazinylpenta-1,3-dien-1-amine;methylthallium (CID 143256524) is (1Z,3E)-3-hydrazinylpenta-1,3-dien-1-amine;methylthallium.
What is the SMILES notation for (1Z,3E)-3-hydrazinylpenta-1,3-dien-1-amine;methylthallium?
The canonical SMILES for (1Z,3E)-3-hydrazinylpenta-1,3-dien-1-amine;methylthallium is C/C=C(\C=C/N)NN.C[Tl].
What is the InChIKey of (1Z,3E)-3-hydrazinylpenta-1,3-dien-1-amine;methylthallium?
The InChIKey is IFZDRQVGEUNYBD-MUGVSWDDSA-N. The full InChI is InChI=1S/C5H11N3.CH3.Tl/c1-2-5(8-7)3-4-6;;/h2-4,8H,6-7H2,1H3;1H3;/b4-3-,5-2+;;.
What are the key properties of (1Z,3E)-3-hydrazinylpenta-1,3-dien-1-amine;methylthallium?
(1Z,3E)-3-hydrazinylpenta-1,3-dien-1-amine;methylthallium has a molecular weight of 332.58 g/mol, XLogP of 0.03, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z,3E)-3-hydrazinylpenta-1,3-dien-1-amine;methylthallium is sourced from PubChem (CID 143256524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).