About ethane;(6E)-2-methyl-5-methylidene-6-(2-methylprop-2-enylidene)-3,4-dihydropyridine
ethane;(6E)-2-methyl-5-methylidene-6-(2-methylprop-2-enylidene)-3,4-dihydropyridine (PubChem CID 143256636) has the molecular formula C15H27N
and a molecular weight of 221.39 g/mol. Its IUPAC name is ethane;(6E)-2-methyl-5-methylidene-6-(2-methylprop-2-enylidene)-3,4-dihydropyridine.
Molecular Properties
| Compound Name | ethane;(6E)-2-methyl-5-methylidene-6-(2-methylprop-2-enylidene)-3,4-dihydropyridine |
| PubChem CID | 143256636 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | ethane;(6E)-2-methyl-5-methylidene-6-(2-methylprop-2-enylidene)-3,4-dihydropyridine |
| SMILES | C=C(C)/C=C1/N=C(C)CCC1=C.CC.CC |
| InChI | InChI=1S/C11H15N.2C2H6/c1-8(2)7-11-9(3)5-6-10(4)12-11;2*1-2/h7H,1,3,5-6H2,2,4H3;2*1-2H3/b11-7+;; |
| InChIKey | KBXRQHOINDJJHP-FCVAESPPSA-N |
| XLogP | 5.31 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;(6E)-2-methyl-5-methylidene-6-(2-methylprop-2-enylidene)-3,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(6E)-2-methyl-5-methylidene-6-(2-methylprop-2-enylidene)-3,4-dihydropyridine?
The IUPAC name of ethane;(6E)-2-methyl-5-methylidene-6-(2-methylprop-2-enylidene)-3,4-dihydropyridine (CID 143256636) is ethane;(6E)-2-methyl-5-methylidene-6-(2-methylprop-2-enylidene)-3,4-dihydropyridine.
What is the SMILES notation for ethane;(6E)-2-methyl-5-methylidene-6-(2-methylprop-2-enylidene)-3,4-dihydropyridine?
The canonical SMILES for ethane;(6E)-2-methyl-5-methylidene-6-(2-methylprop-2-enylidene)-3,4-dihydropyridine is C=C(C)/C=C1/N=C(C)CCC1=C.CC.CC.
What is the InChIKey of ethane;(6E)-2-methyl-5-methylidene-6-(2-methylprop-2-enylidene)-3,4-dihydropyridine?
The InChIKey is KBXRQHOINDJJHP-FCVAESPPSA-N. The full InChI is InChI=1S/C11H15N.2C2H6/c1-8(2)7-11-9(3)5-6-10(4)12-11;2*1-2/h7H,1,3,5-6H2,2,4H3;2*1-2H3/b11-7+;;.
What are the key properties of ethane;(6E)-2-methyl-5-methylidene-6-(2-methylprop-2-enylidene)-3,4-dihydropyridine?
ethane;(6E)-2-methyl-5-methylidene-6-(2-methylprop-2-enylidene)-3,4-dihydropyridine has a molecular weight of 221.39 g/mol, XLogP of 5.31, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(6E)-2-methyl-5-methylidene-6-(2-methylprop-2-enylidene)-3,4-dihydropyridine is sourced from PubChem (CID 143256636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).