About ethane;N-methylmethanimine;2-methylprop-1-en-1-amine
ethane;N-methylmethanimine;2-methylprop-1-en-1-amine (PubChem CID 143256856) has the molecular formula C10H26N2
and a molecular weight of 174.33 g/mol. Its IUPAC name is ethane;N-methylmethanimine;2-methylprop-1-en-1-amine.
Molecular Properties
| Compound Name | ethane;N-methylmethanimine;2-methylprop-1-en-1-amine |
| PubChem CID | 143256856 |
| Molecular Formula | C10H26N2 |
| Molecular Weight | 174.33 g/mol |
| Exact Mass | 174.21 |
| IUPAC Name | ethane;N-methylmethanimine;2-methylprop-1-en-1-amine |
| SMILES | C=NC.CC.CC.CC(C)=CN |
| InChI | InChI=1S/C4H9N.C2H5N.2C2H6/c1-4(2)3-5;1-3-2;2*1-2/h3H,5H2,1-2H3;1H2,2H3;2*1-2H3 |
| InChIKey | LPJKVFZKOMWOGZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.33 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-methylmethanimine;2-methylprop-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-methylmethanimine;2-methylprop-1-en-1-amine?
The IUPAC name of ethane;N-methylmethanimine;2-methylprop-1-en-1-amine (CID 143256856) is ethane;N-methylmethanimine;2-methylprop-1-en-1-amine.
What is the SMILES notation for ethane;N-methylmethanimine;2-methylprop-1-en-1-amine?
The canonical SMILES for ethane;N-methylmethanimine;2-methylprop-1-en-1-amine is C=NC.CC.CC.CC(C)=CN.
What is the InChIKey of ethane;N-methylmethanimine;2-methylprop-1-en-1-amine?
The InChIKey is LPJKVFZKOMWOGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N.C2H5N.2C2H6/c1-4(2)3-5;1-3-2;2*1-2/h3H,5H2,1-2H3;1H2,2H3;2*1-2H3.
What are the key properties of ethane;N-methylmethanimine;2-methylprop-1-en-1-amine?
ethane;N-methylmethanimine;2-methylprop-1-en-1-amine has a molecular weight of 174.33 g/mol, XLogP of 3.24, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-methylmethanimine;2-methylprop-1-en-1-amine is sourced from PubChem (CID 143256856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).