C26H20F3NO3 — CID 143256872
2-hydroxy-5-methyl-N-[2-(4-methylnaphthalen-1-yl)oxy-5-(trifluoromethyl)phenyl]benzamide (PubChem CID 143256872) has the molecular formula C26H20F3NO3 and a molecular weight of 451.44 g/mol. Its IUPAC name is 2-hydroxy-5-methyl-N-[2-(4-methylnaphthalen-1-yl)oxy-5-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 2-hydroxy-5-methyl-N-[2-(4-methylnaphthalen-1-yl)oxy-5-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 143256872 |
| Molecular Formula | C26H20F3NO3 |
| Molecular Weight | 451.44 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | 2-hydroxy-5-methyl-N-[2-(4-methylnaphthalen-1-yl)oxy-5-(trifluoromethyl)phenyl]benzamide |
| SMILES | Cc1ccc(O)c(C(=O)Nc2cc(C(F)(F)F)ccc2Oc2ccc(C)c3ccccc23)c1 |
| InChI | InChI=1S/C26H20F3NO3/c1-15-7-10-22(31)20(13-15)25(32)30-21-14-17(26(27,28)29)9-12-24(21)33-23-11-8-16(2)18-5-3-4-6-19(18)23/h3-14,31H,1-2H3,(H,30,32) |
| InChIKey | SLUKABQRVBALGT-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.44 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |