C24H26ClN5O — CID 143257392
5-(4-chlorophenyl)-N,N'-dimethyl-4-(2-oxopyrrolidin-1-yl)-N-(1-phenylethenyl)-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 143257392) has the molecular formula C24H26ClN5O and a molecular weight of 435.96 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N,N'-dimethyl-4-(2-oxopyrrolidin-1-yl)-N-(1-phenylethenyl)-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | 5-(4-chlorophenyl)-N,N'-dimethyl-4-(2-oxopyrrolidin-1-yl)-N-(1-phenylethenyl)-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 143257392 |
| Molecular Formula | C24H26ClN5O |
| Molecular Weight | 435.96 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 5-(4-chlorophenyl)-N,N'-dimethyl-4-(2-oxopyrrolidin-1-yl)-N-(1-phenylethenyl)-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | C=C(c1ccccc1)N(C)/C(=N\C)N1CC(N2CCCC2=O)C(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C24H26ClN5O/c1-17(18-8-5-4-6-9-18)28(3)24(26-2)30-16-21(29-15-7-10-22(29)31)23(27-30)19-11-13-20(25)14-12-19/h4-6,8-9,11-14,21H,1,7,10,15-16H2,2-3H3/b26-24+ |
| InChIKey | XMUCJFIMDBHYPL-SHHOIMCASA-N |
| XLogP | 3.94 |
| TPSA | 51.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.96 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|