C28H48N4 — CID 143257801
1-cyclohexa-1,5-dien-1-yl-4-[5-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]piperazin-1-yl]-2,4,4-trimethylpentan-2-yl]piperazine (PubChem CID 143257801) has the molecular formula C28H48N4 and a molecular weight of 440.72 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-yl-4-[5-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]piperazin-1-yl]-2,4,4-trimethylpentan-2-yl]piperazine.
| Compound Name | 1-cyclohexa-1,5-dien-1-yl-4-[5-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]piperazin-1-yl]-2,4,4-trimethylpentan-2-yl]piperazine |
|---|---|
| PubChem CID | 143257801 |
| Molecular Formula | C28H48N4 |
| Molecular Weight | 440.72 g/mol |
| Exact Mass | 440.39 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-yl-4-[5-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]piperazin-1-yl]-2,4,4-trimethylpentan-2-yl]piperazine |
| SMILES | C/C=C\C(=C/C)N1CCN(CC(C)(C)CC(C)(C)N2CCN(C3=CCCC=C3)CC2)CC1 |
| InChI | InChI=1S/C28H48N4/c1-7-12-25(8-2)30-17-15-29(16-18-30)24-27(3,4)23-28(5,6)32-21-19-31(20-22-32)26-13-10-9-11-14-26/h7-8,10,12-14H,9,11,15-24H2,1-6H3/b12-7-,25-8+ |
| InChIKey | WOKQBHPVOHXEHL-QOEAZALHSA-N |
| XLogP | 5.13 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.72 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|