C17H24N2O — CID 143257826
5,12-dimethyl-5,8-diazatetracyclo[8.5.0.03,8.011,13]pentadeca-1(10),2,14-trien-4-one;ethane (PubChem CID 143257826) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is 5,12-dimethyl-5,8-diazatetracyclo[8.5.0.03,8.011,13]pentadeca-1(10),2,14-trien-4-one;ethane.
| Compound Name | 5,12-dimethyl-5,8-diazatetracyclo[8.5.0.03,8.011,13]pentadeca-1(10),2,14-trien-4-one;ethane |
|---|---|
| PubChem CID | 143257826 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 5,12-dimethyl-5,8-diazatetracyclo[8.5.0.03,8.011,13]pentadeca-1(10),2,14-trien-4-one;ethane |
| SMILES | CC.CC1C2C=CC3=C(CN4CCN(C)C(=O)C4=C3)C12 |
| InChI | InChI=1S/C15H18N2O.C2H6/c1-9-11-4-3-10-7-13-15(18)16(2)5-6-17(13)8-12(10)14(9)11;1-2/h3-4,7,9,11,14H,5-6,8H2,1-2H3;1-2H3 |
| InChIKey | PCQMDTNWFKDJSV-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |