2-(2,4,6-trimethylanilino)pyridine-3-carboxylic acid

C15H16N2O2 — CID 1432582

IUPAC2-(2,4,6-trimethylanilino)pyridine-3-carboxylic acid
SMILESCc1cc(C)c(Nc2ncccc2C(=O)O)c(C)c1
InChIInChI=1S/C15H16N2O2/c1-9-7-10(2)13(11(3)8-9)17-14-12(15(18)19)5-4-6-16-14/h4-8H,1-3H3,(H,16,17)(H,18,19)
InChIKeyOKVJKWMXVQISOY-UHFFFAOYSA-N
MW256.31 g/mol
LogP3.45
Rot. Bonds3

About 2-(2,4,6-trimethylanilino)pyridine-3-carboxylic acid

2-(2,4,6-trimethylanilino)pyridine-3-carboxylic acid (PubChem CID 1432582) has the molecular formula C15H16N2O2 and a molecular weight of 256.31 g/mol. Its IUPAC name is 2-(2,4,6-trimethylanilino)pyridine-3-carboxylic acid.

Molecular Properties

Compound Name2-(2,4,6-trimethylanilino)pyridine-3-carboxylic acid
PubChem CID1432582
Molecular FormulaC15H16N2O2
Molecular Weight256.31 g/mol
Exact Mass256.12
IUPAC Name2-(2,4,6-trimethylanilino)pyridine-3-carboxylic acid
SMILESCc1cc(C)c(Nc2ncccc2C(=O)O)c(C)c1
InChIInChI=1S/C15H16N2O2/c1-9-7-10(2)13(11(3)8-9)17-14-12(15(18)19)5-4-6-16-14/h4-8H,1-3H3,(H,16,17)(H,18,19)
InChIKeyOKVJKWMXVQISOY-UHFFFAOYSA-N
XLogP3.45
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.31
LogP ≤ 53.45
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-(2,4,6-trimethylanilino)pyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,4,6-trimethylanilino)pyridine-3-carboxylic acid?
The IUPAC name of 2-(2,4,6-trimethylanilino)pyridine-3-carboxylic acid (CID 1432582) is 2-(2,4,6-trimethylanilino)pyridine-3-carboxylic acid.
What is the SMILES notation for 2-(2,4,6-trimethylanilino)pyridine-3-carboxylic acid?
The canonical SMILES for 2-(2,4,6-trimethylanilino)pyridine-3-carboxylic acid is Cc1cc(C)c(Nc2ncccc2C(=O)O)c(C)c1.
What is the InChIKey of 2-(2,4,6-trimethylanilino)pyridine-3-carboxylic acid?
The InChIKey is OKVJKWMXVQISOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O2/c1-9-7-10(2)13(11(3)8-9)17-14-12(15(18)19)5-4-6-16-14/h4-8H,1-3H3,(H,16,17)(H,18,19).
What are the key properties of 2-(2,4,6-trimethylanilino)pyridine-3-carboxylic acid?
2-(2,4,6-trimethylanilino)pyridine-3-carboxylic acid has a molecular weight of 256.31 g/mol, XLogP of 3.45, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4,6-trimethylanilino)pyridine-3-carboxylic acid is sourced from PubChem (CID 1432582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).