C9H10ClF3 — CID 143258494
(1E,3Z,5E)-1-chloro-7,7,7-trifluoro-4,6-dimethylhepta-1,3,5-triene (PubChem CID 143258494) has the molecular formula C9H10ClF3 and a molecular weight of 210.63 g/mol. Its IUPAC name is (1E,3Z,5E)-1-chloro-7,7,7-trifluoro-4,6-dimethylhepta-1,3,5-triene.
| Compound Name | (1E,3Z,5E)-1-chloro-7,7,7-trifluoro-4,6-dimethylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 143258494 |
| Molecular Formula | C9H10ClF3 |
| Molecular Weight | 210.63 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | (1E,3Z,5E)-1-chloro-7,7,7-trifluoro-4,6-dimethylhepta-1,3,5-triene |
| SMILES | CC(=C/C=C/Cl)/C=C(\C)C(F)(F)F |
| InChI | InChI=1S/C9H10ClF3/c1-7(4-3-5-10)6-8(2)9(11,12)13/h3-6H,1-2H3/b5-3+,7-4-,8-6+ |
| InChIKey | HAPDMWQRAYSLND-DIDNWENSSA-N |
| XLogP | 4.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.63 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|