C23H28N4O — CID 143258541
4-[6-butanimidoyl-2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-5-(methylamino)pyrimidin-4-yl]-2-methylphenol (PubChem CID 143258541) has the molecular formula C23H28N4O and a molecular weight of 376.50 g/mol. Its IUPAC name is 4-[6-butanimidoyl-2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-5-(methylamino)pyrimidin-4-yl]-2-methylphenol.
| Compound Name | 4-[6-butanimidoyl-2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-5-(methylamino)pyrimidin-4-yl]-2-methylphenol |
|---|---|
| PubChem CID | 143258541 |
| Molecular Formula | C23H28N4O |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | 4-[6-butanimidoyl-2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-5-(methylamino)pyrimidin-4-yl]-2-methylphenol |
| SMILES | [H]/N=C(\CCC)c1nc(/C(C=C)=C/C=C\C)nc(-c2ccc(O)c(C)c2)c1NC |
| InChI | InChI=1S/C23H28N4O/c1-6-9-11-16(8-3)23-26-20(17-12-13-19(28)15(4)14-17)22(25-5)21(27-23)18(24)10-7-2/h6,8-9,11-14,24-25,28H,3,7,10H2,1-2,4-5H3/b9-6-,16-11+,24-18+ |
| InChIKey | ONHHTQJAFFDJDQ-JVBBXXMFSA-N |
| XLogP | 5.51 |
| TPSA | 81.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|