C32H45F6N3O2 — CID 143258765
methyl N-[[2-[cyclopentylmethyl(ethyl)amino]-5,6,7,8-tetrahydroquinolin-3-yl]methyl]-N-[(E)-5,5,5-trifluoropent-2-enyl]carbamate;(3E)-3-(trifluoromethyl)hexa-1,3-diene (PubChem CID 143258765) has the molecular formula C32H45F6N3O2 and a molecular weight of 617.72 g/mol. Its IUPAC name is methyl N-[[2-[cyclopentylmethyl(ethyl)amino]-5,6,7,8-tetrahydroquinolin-3-yl]methyl]-N-[(E)-5,5,5-trifluoropent-2-enyl]carbamate;(3E)-3-(trifluoromethyl)hexa-1,3-diene.
| Compound Name | methyl N-[[2-[cyclopentylmethyl(ethyl)amino]-5,6,7,8-tetrahydroquinolin-3-yl]methyl]-N-[(E)-5,5,5-trifluoropent-2-enyl]carbamate;(3E)-3-(trifluoromethyl)hexa-1,3-diene |
|---|---|
| PubChem CID | 143258765 |
| Molecular Formula | C32H45F6N3O2 |
| Molecular Weight | 617.72 g/mol |
| Exact Mass | 617.34 |
| IUPAC Name | methyl N-[[2-[cyclopentylmethyl(ethyl)amino]-5,6,7,8-tetrahydroquinolin-3-yl]methyl]-N-[(E)-5,5,5-trifluoropent-2-enyl]carbamate;(3E)-3-(trifluoromethyl)hexa-1,3-diene |
| SMILES | C=C/C(=C\CC)C(F)(F)F.CCN(CC1CCCC1)c1nc2c(cc1CN(C/C=C/CC(F)(F)F)C(=O)OC)CCCC2 |
| InChI | InChI=1S/C25H36F3N3O2.C7H9F3/c1-3-30(17-19-10-4-5-11-19)23-21(16-20-12-6-7-13-22(20)29-23)18-31(24(32)33-2)15-9-8-14-25(26,27)28;1-3-5-6(4-2)7(8,9)10/h8-9,16,19H,3-7,10-15,17-18H2,1-2H3;4-5H,2-3H2,1H3/b9-8+;6-5+ |
| InChIKey | MAXZAHLMLNINHW-YXSOEVJVSA-N |
| XLogP | 9.12 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.72 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|