About 5-bromo-6-methyl-1,3-benzodioxole;ethane
5-bromo-6-methyl-1,3-benzodioxole;ethane (PubChem CID 143259680) has the molecular formula C12H19BrO2
and a molecular weight of 275.19 g/mol. Its IUPAC name is 5-bromo-6-methyl-1,3-benzodioxole;ethane.
Molecular Properties
| Compound Name | 5-bromo-6-methyl-1,3-benzodioxole;ethane |
| PubChem CID | 143259680 |
| Molecular Formula | C12H19BrO2 |
| Molecular Weight | 275.19 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 5-bromo-6-methyl-1,3-benzodioxole;ethane |
| SMILES | CC.CC.Cc1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C8H7BrO2.2C2H6/c1-5-2-7-8(3-6(5)9)11-4-10-7;2*1-2/h2-3H,4H2,1H3;2*1-2H3 |
| InChIKey | OIDSYDLLRMPZRG-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.19 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-6-methyl-1,3-benzodioxole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-6-methyl-1,3-benzodioxole;ethane?
The IUPAC name of 5-bromo-6-methyl-1,3-benzodioxole;ethane (CID 143259680) is 5-bromo-6-methyl-1,3-benzodioxole;ethane.
What is the SMILES notation for 5-bromo-6-methyl-1,3-benzodioxole;ethane?
The canonical SMILES for 5-bromo-6-methyl-1,3-benzodioxole;ethane is CC.CC.Cc1cc2c(cc1Br)OCO2.
What is the InChIKey of 5-bromo-6-methyl-1,3-benzodioxole;ethane?
The InChIKey is OIDSYDLLRMPZRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrO2.2C2H6/c1-5-2-7-8(3-6(5)9)11-4-10-7;2*1-2/h2-3H,4H2,1H3;2*1-2H3.
What are the key properties of 5-bromo-6-methyl-1,3-benzodioxole;ethane?
5-bromo-6-methyl-1,3-benzodioxole;ethane has a molecular weight of 275.19 g/mol, XLogP of 4.54, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-6-methyl-1,3-benzodioxole;ethane is sourced from PubChem (CID 143259680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).