About ethane;N-(2-methoxyethyl)-N,4-dimethylcyclohexa-1,3-dien-1-amine
ethane;N-(2-methoxyethyl)-N,4-dimethylcyclohexa-1,3-dien-1-amine (PubChem CID 143259688) has the molecular formula C13H25NO
and a molecular weight of 211.35 g/mol. Its IUPAC name is ethane;N-(2-methoxyethyl)-N,4-dimethylcyclohexa-1,3-dien-1-amine.
Molecular Properties
| Compound Name | ethane;N-(2-methoxyethyl)-N,4-dimethylcyclohexa-1,3-dien-1-amine |
| PubChem CID | 143259688 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | ethane;N-(2-methoxyethyl)-N,4-dimethylcyclohexa-1,3-dien-1-amine |
| SMILES | CC.COCCN(C)C1=CC=C(C)CC1 |
| InChI | InChI=1S/C11H19NO.C2H6/c1-10-4-6-11(7-5-10)12(2)8-9-13-3;1-2/h4,6H,5,7-9H2,1-3H3;1-2H3 |
| InChIKey | MRWJZTYPOFZUNN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;N-(2-methoxyethyl)-N,4-dimethylcyclohexa-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-(2-methoxyethyl)-N,4-dimethylcyclohexa-1,3-dien-1-amine?
The IUPAC name of ethane;N-(2-methoxyethyl)-N,4-dimethylcyclohexa-1,3-dien-1-amine (CID 143259688) is ethane;N-(2-methoxyethyl)-N,4-dimethylcyclohexa-1,3-dien-1-amine.
What is the SMILES notation for ethane;N-(2-methoxyethyl)-N,4-dimethylcyclohexa-1,3-dien-1-amine?
The canonical SMILES for ethane;N-(2-methoxyethyl)-N,4-dimethylcyclohexa-1,3-dien-1-amine is CC.COCCN(C)C1=CC=C(C)CC1.
What is the InChIKey of ethane;N-(2-methoxyethyl)-N,4-dimethylcyclohexa-1,3-dien-1-amine?
The InChIKey is MRWJZTYPOFZUNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO.C2H6/c1-10-4-6-11(7-5-10)12(2)8-9-13-3;1-2/h4,6H,5,7-9H2,1-3H3;1-2H3.
What are the key properties of ethane;N-(2-methoxyethyl)-N,4-dimethylcyclohexa-1,3-dien-1-amine?
ethane;N-(2-methoxyethyl)-N,4-dimethylcyclohexa-1,3-dien-1-amine has a molecular weight of 211.35 g/mol, XLogP of 3.21, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-(2-methoxyethyl)-N,4-dimethylcyclohexa-1,3-dien-1-amine is sourced from PubChem (CID 143259688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).