C25H45N — CID 143259800
ethane;6-[1-[4-[(Z)-2-methyloct-6-enyl]cyclohex-2-en-1-yl]propan-2-yl]-1,2,3,6-tetrahydropyridine (PubChem CID 143259800) has the molecular formula C25H45N and a molecular weight of 359.64 g/mol. Its IUPAC name is ethane;6-[1-[4-[(Z)-2-methyloct-6-enyl]cyclohex-2-en-1-yl]propan-2-yl]-1,2,3,6-tetrahydropyridine.
| Compound Name | ethane;6-[1-[4-[(Z)-2-methyloct-6-enyl]cyclohex-2-en-1-yl]propan-2-yl]-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 143259800 |
| Molecular Formula | C25H45N |
| Molecular Weight | 359.64 g/mol |
| Exact Mass | 359.36 |
| IUPAC Name | ethane;6-[1-[4-[(Z)-2-methyloct-6-enyl]cyclohex-2-en-1-yl]propan-2-yl]-1,2,3,6-tetrahydropyridine |
| SMILES | C/C=C\CCCC(C)CC1C=CC(CC(C)C2C=CCCN2)CC1.CC |
| InChI | InChI=1S/C23H39N.C2H6/c1-4-5-6-7-10-19(2)17-21-12-14-22(15-13-21)18-20(3)23-11-8-9-16-24-23;1-2/h4-5,8,11-12,14,19-24H,6-7,9-10,13,15-18H2,1-3H3;1-2H3/b5-4-; |
| InChIKey | QIIWIMZOOGFQCE-MKWAYWHRSA-N |
| XLogP | 7.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.64 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|