About 5-iodo-5-methyl-1,4-diazepane
5-iodo-5-methyl-1,4-diazepane (PubChem CID 143260157) has the molecular formula C6H13IN2
and a molecular weight of 240.09 g/mol. Its IUPAC name is 5-iodo-5-methyl-1,4-diazepane.
Molecular Properties
| Compound Name | 5-iodo-5-methyl-1,4-diazepane |
| PubChem CID | 143260157 |
| Molecular Formula | C6H13IN2 |
| Molecular Weight | 240.09 g/mol |
| Exact Mass | 240.01 |
| IUPAC Name | 5-iodo-5-methyl-1,4-diazepane |
| SMILES | CC1(I)CCNCCN1 |
| InChI | InChI=1S/C6H13IN2/c1-6(7)2-3-8-4-5-9-6/h8-9H,2-5H2,1H3 |
| InChIKey | OQNNXKUIRBQFRP-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.09 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-5-methyl-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-5-methyl-1,4-diazepane?
The IUPAC name of 5-iodo-5-methyl-1,4-diazepane (CID 143260157) is 5-iodo-5-methyl-1,4-diazepane.
What is the SMILES notation for 5-iodo-5-methyl-1,4-diazepane?
The canonical SMILES for 5-iodo-5-methyl-1,4-diazepane is CC1(I)CCNCCN1.
What is the InChIKey of 5-iodo-5-methyl-1,4-diazepane?
The InChIKey is OQNNXKUIRBQFRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13IN2/c1-6(7)2-3-8-4-5-9-6/h8-9H,2-5H2,1H3.
What are the key properties of 5-iodo-5-methyl-1,4-diazepane?
5-iodo-5-methyl-1,4-diazepane has a molecular weight of 240.09 g/mol, XLogP of 0.72, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-5-methyl-1,4-diazepane is sourced from PubChem (CID 143260157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).