About (3R)-3-amino-3-methyl-1,2-dihydroisoquinoline-4-thione
(3R)-3-amino-3-methyl-1,2-dihydroisoquinoline-4-thione (PubChem CID 143260160) has the molecular formula C10H12N2S
and a molecular weight of 192.29 g/mol. Its IUPAC name is (3R)-3-amino-3-methyl-1,2-dihydroisoquinoline-4-thione.
Molecular Properties
| Compound Name | (3R)-3-amino-3-methyl-1,2-dihydroisoquinoline-4-thione |
| PubChem CID | 143260160 |
| Molecular Formula | C10H12N2S |
| Molecular Weight | 192.29 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | (3R)-3-amino-3-methyl-1,2-dihydroisoquinoline-4-thione |
| SMILES | C[C@@]1(N)NCc2ccccc2C1=S |
| InChI | InChI=1S/C10H12N2S/c1-10(11)9(13)8-5-3-2-4-7(8)6-12-10/h2-5,12H,6,11H2,1H3/t10-/m1/s1 |
| InChIKey | JCOIHPDFQTVDMH-SNVBAGLBSA-N |
| XLogP | 1.18 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.29 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-amino-3-methyl-1,2-dihydroisoquinoline-4-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-amino-3-methyl-1,2-dihydroisoquinoline-4-thione?
The IUPAC name of (3R)-3-amino-3-methyl-1,2-dihydroisoquinoline-4-thione (CID 143260160) is (3R)-3-amino-3-methyl-1,2-dihydroisoquinoline-4-thione.
What is the SMILES notation for (3R)-3-amino-3-methyl-1,2-dihydroisoquinoline-4-thione?
The canonical SMILES for (3R)-3-amino-3-methyl-1,2-dihydroisoquinoline-4-thione is C[C@@]1(N)NCc2ccccc2C1=S.
What is the InChIKey of (3R)-3-amino-3-methyl-1,2-dihydroisoquinoline-4-thione?
The InChIKey is JCOIHPDFQTVDMH-SNVBAGLBSA-N. The full InChI is InChI=1S/C10H12N2S/c1-10(11)9(13)8-5-3-2-4-7(8)6-12-10/h2-5,12H,6,11H2,1H3/t10-/m1/s1.
What are the key properties of (3R)-3-amino-3-methyl-1,2-dihydroisoquinoline-4-thione?
(3R)-3-amino-3-methyl-1,2-dihydroisoquinoline-4-thione has a molecular weight of 192.29 g/mol, XLogP of 1.18, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-amino-3-methyl-1,2-dihydroisoquinoline-4-thione is sourced from PubChem (CID 143260160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).