C16H26N4O — CID 143260256
1-(1,5,6,7,8,8a-hexahydroquinolin-4-ylmethyl)-3-[(3R)-1-methylpyrrolidin-3-yl]urea (PubChem CID 143260256) has the molecular formula C16H26N4O and a molecular weight of 290.41 g/mol. Its IUPAC name is 1-(1,5,6,7,8,8a-hexahydroquinolin-4-ylmethyl)-3-[(3R)-1-methylpyrrolidin-3-yl]urea.
| Compound Name | 1-(1,5,6,7,8,8a-hexahydroquinolin-4-ylmethyl)-3-[(3R)-1-methylpyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 143260256 |
| Molecular Formula | C16H26N4O |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | 1-(1,5,6,7,8,8a-hexahydroquinolin-4-ylmethyl)-3-[(3R)-1-methylpyrrolidin-3-yl]urea |
| SMILES | CN1CC[C@@H](NC(=O)NCC2=C3CCCCC3NC=C2)C1 |
| InChI | InChI=1S/C16H26N4O/c1-20-9-7-13(11-20)19-16(21)18-10-12-6-8-17-15-5-3-2-4-14(12)15/h6,8,13,15,17H,2-5,7,9-11H2,1H3,(H2,18,19,21)/t13-,15?/m1/s1 |
| InChIKey | WJWVVJFTCXDTRE-AFYYWNPRSA-N |
| XLogP | 1.35 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |