About (E)-N-ethenyl-3-methylpent-2-en-1-imine;1-methylpyrrolidine;prop-1-en-2-amine
(E)-N-ethenyl-3-methylpent-2-en-1-imine;1-methylpyrrolidine;prop-1-en-2-amine (PubChem CID 143260278) has the molecular formula C16H31N3
and a molecular weight of 265.44 g/mol. Its IUPAC name is (E)-N-ethenyl-3-methylpent-2-en-1-imine;1-methylpyrrolidine;prop-1-en-2-amine.
Molecular Properties
| Compound Name | (E)-N-ethenyl-3-methylpent-2-en-1-imine;1-methylpyrrolidine;prop-1-en-2-amine |
| PubChem CID | 143260278 |
| Molecular Formula | C16H31N3 |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.25 |
| IUPAC Name | (E)-N-ethenyl-3-methylpent-2-en-1-imine;1-methylpyrrolidine;prop-1-en-2-amine |
| SMILES | C=C(C)N.C=C/N=C/C=C(\C)CC.CN1CCCC1 |
| InChI | InChI=1S/C8H13N.C5H11N.C3H7N/c1-4-8(3)6-7-9-5-2;1-6-4-2-3-5-6;1-3(2)4/h5-7H,2,4H2,1,3H3;2-5H2,1H3;1,4H2,2H3/b8-6+,9-7+;; |
| InChIKey | SABPYKIFLAJCSC-IWBCLEKBSA-N |
| XLogP | 3.75 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-ethenyl-3-methylpent-2-en-1-imine;1-methylpyrrolidine;prop-1-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-ethenyl-3-methylpent-2-en-1-imine;1-methylpyrrolidine;prop-1-en-2-amine?
The IUPAC name of (E)-N-ethenyl-3-methylpent-2-en-1-imine;1-methylpyrrolidine;prop-1-en-2-amine (CID 143260278) is (E)-N-ethenyl-3-methylpent-2-en-1-imine;1-methylpyrrolidine;prop-1-en-2-amine.
What is the SMILES notation for (E)-N-ethenyl-3-methylpent-2-en-1-imine;1-methylpyrrolidine;prop-1-en-2-amine?
The canonical SMILES for (E)-N-ethenyl-3-methylpent-2-en-1-imine;1-methylpyrrolidine;prop-1-en-2-amine is C=C(C)N.C=C/N=C/C=C(\C)CC.CN1CCCC1.
What is the InChIKey of (E)-N-ethenyl-3-methylpent-2-en-1-imine;1-methylpyrrolidine;prop-1-en-2-amine?
The InChIKey is SABPYKIFLAJCSC-IWBCLEKBSA-N. The full InChI is InChI=1S/C8H13N.C5H11N.C3H7N/c1-4-8(3)6-7-9-5-2;1-6-4-2-3-5-6;1-3(2)4/h5-7H,2,4H2,1,3H3;2-5H2,1H3;1,4H2,2H3/b8-6+,9-7+;;.
What are the key properties of (E)-N-ethenyl-3-methylpent-2-en-1-imine;1-methylpyrrolidine;prop-1-en-2-amine?
(E)-N-ethenyl-3-methylpent-2-en-1-imine;1-methylpyrrolidine;prop-1-en-2-amine has a molecular weight of 265.44 g/mol, XLogP of 3.75, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-ethenyl-3-methylpent-2-en-1-imine;1-methylpyrrolidine;prop-1-en-2-amine is sourced from PubChem (CID 143260278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).