About 1-methylpyrrolidine;2-[[(Z)-prop-1-enyl]iminomethylimino]propylurea
1-methylpyrrolidine;2-[[(Z)-prop-1-enyl]iminomethylimino]propylurea (PubChem CID 143260306) has the molecular formula C13H25N5O
and a molecular weight of 267.38 g/mol. Its IUPAC name is 1-methylpyrrolidine;2-[[(Z)-prop-1-enyl]iminomethylimino]propylurea.
Molecular Properties
| Compound Name | 1-methylpyrrolidine;2-[[(Z)-prop-1-enyl]iminomethylimino]propylurea |
| PubChem CID | 143260306 |
| Molecular Formula | C13H25N5O |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.21 |
| IUPAC Name | 1-methylpyrrolidine;2-[[(Z)-prop-1-enyl]iminomethylimino]propylurea |
| SMILES | C/C=C\N=C\N=C(/C)CNC(N)=O.CN1CCCC1 |
| InChI | InChI=1S/C8H14N4O.C5H11N/c1-3-4-10-6-12-7(2)5-11-8(9)13;1-6-4-2-3-5-6/h3-4,6H,5H2,1-2H3,(H3,9,11,13);2-5H2,1H3/b4-3-,10-6+,12-7+; |
| InChIKey | XRCPTQLWZBUGJP-GMMHGBAUSA-N |
| XLogP | 1.39 |
| TPSA | 83.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-methylpyrrolidine;2-[[(Z)-prop-1-enyl]iminomethylimino]propylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpyrrolidine;2-[[(Z)-prop-1-enyl]iminomethylimino]propylurea?
The IUPAC name of 1-methylpyrrolidine;2-[[(Z)-prop-1-enyl]iminomethylimino]propylurea (CID 143260306) is 1-methylpyrrolidine;2-[[(Z)-prop-1-enyl]iminomethylimino]propylurea.
What is the SMILES notation for 1-methylpyrrolidine;2-[[(Z)-prop-1-enyl]iminomethylimino]propylurea?
The canonical SMILES for 1-methylpyrrolidine;2-[[(Z)-prop-1-enyl]iminomethylimino]propylurea is C/C=C\N=C\N=C(/C)CNC(N)=O.CN1CCCC1.
What is the InChIKey of 1-methylpyrrolidine;2-[[(Z)-prop-1-enyl]iminomethylimino]propylurea?
The InChIKey is XRCPTQLWZBUGJP-GMMHGBAUSA-N. The full InChI is InChI=1S/C8H14N4O.C5H11N/c1-3-4-10-6-12-7(2)5-11-8(9)13;1-6-4-2-3-5-6/h3-4,6H,5H2,1-2H3,(H3,9,11,13);2-5H2,1H3/b4-3-,10-6+,12-7+;.
What are the key properties of 1-methylpyrrolidine;2-[[(Z)-prop-1-enyl]iminomethylimino]propylurea?
1-methylpyrrolidine;2-[[(Z)-prop-1-enyl]iminomethylimino]propylurea has a molecular weight of 267.38 g/mol, XLogP of 1.39, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpyrrolidine;2-[[(Z)-prop-1-enyl]iminomethylimino]propylurea is sourced from PubChem (CID 143260306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).