About 5-hydroxy-6-methoxy-4,4-dimethyloxan-2-one
5-hydroxy-6-methoxy-4,4-dimethyloxan-2-one (PubChem CID 14326046) has the molecular formula C8H14O4
and a molecular weight of 174.20 g/mol. Its IUPAC name is 5-hydroxy-6-methoxy-4,4-dimethyloxan-2-one.
Molecular Properties
| Compound Name | 5-hydroxy-6-methoxy-4,4-dimethyloxan-2-one |
| PubChem CID | 14326046 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 5-hydroxy-6-methoxy-4,4-dimethyloxan-2-one |
| SMILES | COC1OC(=O)CC(C)(C)C1O |
| InChI | InChI=1S/C8H14O4/c1-8(2)4-5(9)12-7(11-3)6(8)10/h6-7,10H,4H2,1-3H3 |
| InChIKey | QUNANBOWIXHSBQ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-hydroxy-6-methoxy-4,4-dimethyloxan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-6-methoxy-4,4-dimethyloxan-2-one?
The IUPAC name of 5-hydroxy-6-methoxy-4,4-dimethyloxan-2-one (CID 14326046) is 5-hydroxy-6-methoxy-4,4-dimethyloxan-2-one.
What is the SMILES notation for 5-hydroxy-6-methoxy-4,4-dimethyloxan-2-one?
The canonical SMILES for 5-hydroxy-6-methoxy-4,4-dimethyloxan-2-one is COC1OC(=O)CC(C)(C)C1O.
What is the InChIKey of 5-hydroxy-6-methoxy-4,4-dimethyloxan-2-one?
The InChIKey is QUNANBOWIXHSBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O4/c1-8(2)4-5(9)12-7(11-3)6(8)10/h6-7,10H,4H2,1-3H3.
What are the key properties of 5-hydroxy-6-methoxy-4,4-dimethyloxan-2-one?
5-hydroxy-6-methoxy-4,4-dimethyloxan-2-one has a molecular weight of 174.20 g/mol, XLogP of 0.29, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-6-methoxy-4,4-dimethyloxan-2-one is sourced from PubChem (CID 14326046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).