About 5-hydroxy-4,4-dimethyl-6-[(2-methylpropan-2-yl)oxy]oxan-2-one
5-hydroxy-4,4-dimethyl-6-[(2-methylpropan-2-yl)oxy]oxan-2-one (PubChem CID 14326047) has the molecular formula C11H20O4
and a molecular weight of 216.28 g/mol. Its IUPAC name is 5-hydroxy-4,4-dimethyl-6-[(2-methylpropan-2-yl)oxy]oxan-2-one.
Molecular Properties
| Compound Name | 5-hydroxy-4,4-dimethyl-6-[(2-methylpropan-2-yl)oxy]oxan-2-one |
| PubChem CID | 14326047 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 5-hydroxy-4,4-dimethyl-6-[(2-methylpropan-2-yl)oxy]oxan-2-one |
| SMILES | CC(C)(C)OC1OC(=O)CC(C)(C)C1O |
| InChI | InChI=1S/C11H20O4/c1-10(2,3)15-9-8(13)11(4,5)6-7(12)14-9/h8-9,13H,6H2,1-5H3 |
| InChIKey | GHTYGUODSXSHJJ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-hydroxy-4,4-dimethyl-6-[(2-methylpropan-2-yl)oxy]oxan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-4,4-dimethyl-6-[(2-methylpropan-2-yl)oxy]oxan-2-one?
The IUPAC name of 5-hydroxy-4,4-dimethyl-6-[(2-methylpropan-2-yl)oxy]oxan-2-one (CID 14326047) is 5-hydroxy-4,4-dimethyl-6-[(2-methylpropan-2-yl)oxy]oxan-2-one.
What is the SMILES notation for 5-hydroxy-4,4-dimethyl-6-[(2-methylpropan-2-yl)oxy]oxan-2-one?
The canonical SMILES for 5-hydroxy-4,4-dimethyl-6-[(2-methylpropan-2-yl)oxy]oxan-2-one is CC(C)(C)OC1OC(=O)CC(C)(C)C1O.
What is the InChIKey of 5-hydroxy-4,4-dimethyl-6-[(2-methylpropan-2-yl)oxy]oxan-2-one?
The InChIKey is GHTYGUODSXSHJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O4/c1-10(2,3)15-9-8(13)11(4,5)6-7(12)14-9/h8-9,13H,6H2,1-5H3.
What are the key properties of 5-hydroxy-4,4-dimethyl-6-[(2-methylpropan-2-yl)oxy]oxan-2-one?
5-hydroxy-4,4-dimethyl-6-[(2-methylpropan-2-yl)oxy]oxan-2-one has a molecular weight of 216.28 g/mol, XLogP of 1.46, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-4,4-dimethyl-6-[(2-methylpropan-2-yl)oxy]oxan-2-one is sourced from PubChem (CID 14326047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).