C25H38O2 — CID 143260542
1-tert-butyl-4-[[(1Z,3Z,5E)-5-ethylidene-1-methoxy-7-methylocta-1,3,6-trien-2-yl]oxymethyl]benzene;ethane (PubChem CID 143260542) has the molecular formula C25H38O2 and a molecular weight of 370.58 g/mol. Its IUPAC name is 1-tert-butyl-4-[[(1Z,3Z,5E)-5-ethylidene-1-methoxy-7-methylocta-1,3,6-trien-2-yl]oxymethyl]benzene;ethane.
| Compound Name | 1-tert-butyl-4-[[(1Z,3Z,5E)-5-ethylidene-1-methoxy-7-methylocta-1,3,6-trien-2-yl]oxymethyl]benzene;ethane |
|---|---|
| PubChem CID | 143260542 |
| Molecular Formula | C25H38O2 |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 370.29 |
| IUPAC Name | 1-tert-butyl-4-[[(1Z,3Z,5E)-5-ethylidene-1-methoxy-7-methylocta-1,3,6-trien-2-yl]oxymethyl]benzene;ethane |
| SMILES | C/C=C(C=C(C)C)\C=C/C(=C/OC)OCc1ccc(C(C)(C)C)cc1.CC |
| InChI | InChI=1S/C23H32O2.C2H6/c1-8-19(15-18(2)3)11-14-22(17-24-7)25-16-20-9-12-21(13-10-20)23(4,5)6;1-2/h8-15,17H,16H2,1-7H3;1-2H3/b14-11-,19-8+,22-17-; |
| InChIKey | NSVLFWGHTPJIQN-FQALRAKCSA-N |
| XLogP | 7.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|