About (1E,3Z)-1-methoxypenta-1,3-diene-1,4-diamine
(1E,3Z)-1-methoxypenta-1,3-diene-1,4-diamine (PubChem CID 143260703) has the molecular formula C6H12N2O
and a molecular weight of 128.17 g/mol. Its IUPAC name is (1E,3Z)-1-methoxypenta-1,3-diene-1,4-diamine.
Molecular Properties
| Compound Name | (1E,3Z)-1-methoxypenta-1,3-diene-1,4-diamine |
| PubChem CID | 143260703 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | (1E,3Z)-1-methoxypenta-1,3-diene-1,4-diamine |
| SMILES | CO/C(N)=C/C=C(/C)N |
| InChI | InChI=1S/C6H12N2O/c1-5(7)3-4-6(8)9-2/h3-4H,7-8H2,1-2H3/b5-3-,6-4+ |
| InChIKey | JBMYEFYQRAHAIM-CIIODKQPSA-N |
| XLogP | 0.30 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1E,3Z)-1-methoxypenta-1,3-diene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E,3Z)-1-methoxypenta-1,3-diene-1,4-diamine?
The IUPAC name of (1E,3Z)-1-methoxypenta-1,3-diene-1,4-diamine (CID 143260703) is (1E,3Z)-1-methoxypenta-1,3-diene-1,4-diamine.
What is the SMILES notation for (1E,3Z)-1-methoxypenta-1,3-diene-1,4-diamine?
The canonical SMILES for (1E,3Z)-1-methoxypenta-1,3-diene-1,4-diamine is CO/C(N)=C/C=C(/C)N.
What is the InChIKey of (1E,3Z)-1-methoxypenta-1,3-diene-1,4-diamine?
The InChIKey is JBMYEFYQRAHAIM-CIIODKQPSA-N. The full InChI is InChI=1S/C6H12N2O/c1-5(7)3-4-6(8)9-2/h3-4H,7-8H2,1-2H3/b5-3-,6-4+.
What are the key properties of (1E,3Z)-1-methoxypenta-1,3-diene-1,4-diamine?
(1E,3Z)-1-methoxypenta-1,3-diene-1,4-diamine has a molecular weight of 128.17 g/mol, XLogP of 0.30, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1E,3Z)-1-methoxypenta-1,3-diene-1,4-diamine is sourced from PubChem (CID 143260703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).