About 3-(N-[(Z)-butan-2-ylideneamino]-4-fluoroanilino)propanoic acid;ethane
3-(N-[(Z)-butan-2-ylideneamino]-4-fluoroanilino)propanoic acid;ethane (PubChem CID 143260919) has the molecular formula C15H23FN2O2
and a molecular weight of 282.36 g/mol. Its IUPAC name is 3-(N-[(Z)-butan-2-ylideneamino]-4-fluoroanilino)propanoic acid;ethane.
Molecular Properties
| Compound Name | 3-(N-[(Z)-butan-2-ylideneamino]-4-fluoroanilino)propanoic acid;ethane |
| PubChem CID | 143260919 |
| Molecular Formula | C15H23FN2O2 |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 3-(N-[(Z)-butan-2-ylideneamino]-4-fluoroanilino)propanoic acid;ethane |
| SMILES | CC.CC/C(C)=N\N(CCC(=O)O)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H17FN2O2.C2H6/c1-3-10(2)15-16(9-8-13(17)18)12-6-4-11(14)5-7-12;1-2/h4-7H,3,8-9H2,1-2H3,(H,17,18);1-2H3/b15-10-; |
| InChIKey | SXDVNJNDQZGWKT-AZJSCORLSA-N |
| XLogP | 3.92 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(N-[(Z)-butan-2-ylideneamino]-4-fluoroanilino)propanoic acid;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(N-[(Z)-butan-2-ylideneamino]-4-fluoroanilino)propanoic acid;ethane?
The IUPAC name of 3-(N-[(Z)-butan-2-ylideneamino]-4-fluoroanilino)propanoic acid;ethane (CID 143260919) is 3-(N-[(Z)-butan-2-ylideneamino]-4-fluoroanilino)propanoic acid;ethane.
What is the SMILES notation for 3-(N-[(Z)-butan-2-ylideneamino]-4-fluoroanilino)propanoic acid;ethane?
The canonical SMILES for 3-(N-[(Z)-butan-2-ylideneamino]-4-fluoroanilino)propanoic acid;ethane is CC.CC/C(C)=N\N(CCC(=O)O)c1ccc(F)cc1.
What is the InChIKey of 3-(N-[(Z)-butan-2-ylideneamino]-4-fluoroanilino)propanoic acid;ethane?
The InChIKey is SXDVNJNDQZGWKT-AZJSCORLSA-N. The full InChI is InChI=1S/C13H17FN2O2.C2H6/c1-3-10(2)15-16(9-8-13(17)18)12-6-4-11(14)5-7-12;1-2/h4-7H,3,8-9H2,1-2H3,(H,17,18);1-2H3/b15-10-;.
What are the key properties of 3-(N-[(Z)-butan-2-ylideneamino]-4-fluoroanilino)propanoic acid;ethane?
3-(N-[(Z)-butan-2-ylideneamino]-4-fluoroanilino)propanoic acid;ethane has a molecular weight of 282.36 g/mol, XLogP of 3.92, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(N-[(Z)-butan-2-ylideneamino]-4-fluoroanilino)propanoic acid;ethane is sourced from PubChem (CID 143260919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).