C35H37F4N5O6S — CID 143261414
acetylene;methyl N-[3-[(2R)-1-[2-[(1-aminoisoquinolin-6-yl)amino]acetyl]pyrrolidin-2-yl]-4-ethylsulfonylphenyl]carbamate;1,1,2,2-tetrafluoroethoxybenzene (PubChem CID 143261414) has the molecular formula C35H37F4N5O6S and a molecular weight of 731.77 g/mol. Its IUPAC name is acetylene;methyl N-[3-[(2R)-1-[2-[(1-aminoisoquinolin-6-yl)amino]acetyl]pyrrolidin-2-yl]-4-ethylsulfonylphenyl]carbamate;1,1,2,2-tetrafluoroethoxybenzene.
| Compound Name | acetylene;methyl N-[3-[(2R)-1-[2-[(1-aminoisoquinolin-6-yl)amino]acetyl]pyrrolidin-2-yl]-4-ethylsulfonylphenyl]carbamate;1,1,2,2-tetrafluoroethoxybenzene |
|---|---|
| PubChem CID | 143261414 |
| Molecular Formula | C35H37F4N5O6S |
| Molecular Weight | 731.77 g/mol |
| Exact Mass | 731.24 |
| IUPAC Name | acetylene;methyl N-[3-[(2R)-1-[2-[(1-aminoisoquinolin-6-yl)amino]acetyl]pyrrolidin-2-yl]-4-ethylsulfonylphenyl]carbamate;1,1,2,2-tetrafluoroethoxybenzene |
| SMILES | C#C.CCS(=O)(=O)c1ccc(NC(=O)OC)cc1[C@H]1CCCN1C(=O)CNc1ccc2c(N)nccc2c1.FC(F)C(F)(F)Oc1ccccc1 |
| InChI | InChI=1S/C25H29N5O5S.C8H6F4O.C2H2/c1-3-36(33,34)22-9-7-18(29-25(32)35-2)14-20(22)21-5-4-12-30(21)23(31)15-28-17-6-8-19-16(13-17)10-11-27-24(19)26;9-7(10)8(11,12)13-6-4-2-1-3-5-6;1-2/h6-11,13-14,21,28H,3-5,12,15H2,1-2H3,(H2,26,27)(H,29,32);1-5,7H;1-2H/t21-;;/m1../s1 |
| InChIKey | QRVPHPMZAZVIEB-GHVWMZMZSA-N |
| XLogP | 6.74 |
| TPSA | 152.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.77 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|