C11H24N2O2S — CID 143261417
methanesulfonamide;prop-1-ene;2-[(E)-prop-1-enyl]pyrrolidine (PubChem CID 143261417) has the molecular formula C11H24N2O2S and a molecular weight of 248.39 g/mol. Its IUPAC name is methanesulfonamide;prop-1-ene;2-[(E)-prop-1-enyl]pyrrolidine.
| Compound Name | methanesulfonamide;prop-1-ene;2-[(E)-prop-1-enyl]pyrrolidine |
|---|---|
| PubChem CID | 143261417 |
| Molecular Formula | C11H24N2O2S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | methanesulfonamide;prop-1-ene;2-[(E)-prop-1-enyl]pyrrolidine |
| SMILES | C/C=C/C1CCCN1.C=CC.CS(N)(=O)=O |
| InChI | InChI=1S/C7H13N.C3H6.CH5NO2S/c1-2-4-7-5-3-6-8-7;1-3-2;1-5(2,3)4/h2,4,7-8H,3,5-6H2,1H3;3H,1H2,2H3;1H3,(H2,2,3,4)/b4-2+;; |
| InChIKey | VKJZTCUNOQQOBK-IKXJGISXSA-N |
| XLogP | 1.41 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|