About 3-(2,3-dihydro-1H-inden-5-yl)-5-methyltriazolo[4,5-d]pyrimidine
3-(2,3-dihydro-1H-inden-5-yl)-5-methyltriazolo[4,5-d]pyrimidine (PubChem CID 143261620) has the molecular formula C14H13N5
and a molecular weight of 251.29 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-inden-5-yl)-5-methyltriazolo[4,5-d]pyrimidine.
Molecular Properties
| Compound Name | 3-(2,3-dihydro-1H-inden-5-yl)-5-methyltriazolo[4,5-d]pyrimidine |
| PubChem CID | 143261620 |
| Molecular Formula | C14H13N5 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 3-(2,3-dihydro-1H-inden-5-yl)-5-methyltriazolo[4,5-d]pyrimidine |
| SMILES | Cc1ncc2nnn(-c3ccc4c(c3)CCC4)c2n1 |
| InChI | InChI=1S/C14H13N5/c1-9-15-8-13-14(16-9)19(18-17-13)12-6-5-10-3-2-4-11(10)7-12/h5-8H,2-4H2,1H3 |
| InChIKey | JYWGIIWWIABFMW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(2,3-dihydro-1H-inden-5-yl)-5-methyltriazolo[4,5-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3-dihydro-1H-inden-5-yl)-5-methyltriazolo[4,5-d]pyrimidine?
The IUPAC name of 3-(2,3-dihydro-1H-inden-5-yl)-5-methyltriazolo[4,5-d]pyrimidine (CID 143261620) is 3-(2,3-dihydro-1H-inden-5-yl)-5-methyltriazolo[4,5-d]pyrimidine.
What is the SMILES notation for 3-(2,3-dihydro-1H-inden-5-yl)-5-methyltriazolo[4,5-d]pyrimidine?
The canonical SMILES for 3-(2,3-dihydro-1H-inden-5-yl)-5-methyltriazolo[4,5-d]pyrimidine is Cc1ncc2nnn(-c3ccc4c(c3)CCC4)c2n1.
What is the InChIKey of 3-(2,3-dihydro-1H-inden-5-yl)-5-methyltriazolo[4,5-d]pyrimidine?
The InChIKey is JYWGIIWWIABFMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N5/c1-9-15-8-13-14(16-9)19(18-17-13)12-6-5-10-3-2-4-11(10)7-12/h5-8H,2-4H2,1H3.
What are the key properties of 3-(2,3-dihydro-1H-inden-5-yl)-5-methyltriazolo[4,5-d]pyrimidine?
3-(2,3-dihydro-1H-inden-5-yl)-5-methyltriazolo[4,5-d]pyrimidine has a molecular weight of 251.29 g/mol, XLogP of 2.01, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dihydro-1H-inden-5-yl)-5-methyltriazolo[4,5-d]pyrimidine is sourced from PubChem (CID 143261620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).