C15H29NO3 — CID 143261762
3a-amino-3-methyl-3,4,4a,5,6,7,8,8a,9,9a-decahydrobenzo[f][2]benzofuran-1-one;methane;methanol (PubChem CID 143261762) has the molecular formula C15H29NO3 and a molecular weight of 271.40 g/mol. Its IUPAC name is 3a-amino-3-methyl-3,4,4a,5,6,7,8,8a,9,9a-decahydrobenzo[f][2]benzofuran-1-one;methane;methanol.
| Compound Name | 3a-amino-3-methyl-3,4,4a,5,6,7,8,8a,9,9a-decahydrobenzo[f][2]benzofuran-1-one;methane;methanol |
|---|---|
| PubChem CID | 143261762 |
| Molecular Formula | C15H29NO3 |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.21 |
| IUPAC Name | 3a-amino-3-methyl-3,4,4a,5,6,7,8,8a,9,9a-decahydrobenzo[f][2]benzofuran-1-one;methane;methanol |
| SMILES | C.CC1OC(=O)C2CC3CCCCC3CC12N.CO |
| InChI | InChI=1S/C13H21NO2.CH4O.CH4/c1-8-13(14)7-10-5-3-2-4-9(10)6-11(13)12(15)16-8;1-2;/h8-11H,2-7,14H2,1H3;2H,1H3;1H4 |
| InChIKey | ICMCWXJULSXCAT-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |