C12H14N2 — CID 143261930
2,6,8-trimethyl-8H-pyrido[2,3-b]azepine (PubChem CID 143261930) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 2,6,8-trimethyl-8H-pyrido[2,3-b]azepine.
| Compound Name | 2,6,8-trimethyl-8H-pyrido[2,3-b]azepine |
|---|---|
| PubChem CID | 143261930 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 2,6,8-trimethyl-8H-pyrido[2,3-b]azepine |
| SMILES | CC1=CC(C)N=c2nc(C)ccc2=C1 |
| InChI | InChI=1S/C12H14N2/c1-8-6-10(3)14-12-11(7-8)5-4-9(2)13-12/h4-7,10H,1-3H3 |
| InChIKey | FKWOLZVPGJZCKC-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |