C28H39BN6 — CID 143263195
4-(4-aminophenyl)-2H-pyrazolo[3,4-b]pyridin-3-amine;ethane;4-(3,3,4,4-tetramethylborolan-1-yl)aniline (PubChem CID 143263195) has the molecular formula C28H39BN6 and a molecular weight of 470.47 g/mol. Its IUPAC name is 4-(4-aminophenyl)-2H-pyrazolo[3,4-b]pyridin-3-amine;ethane;4-(3,3,4,4-tetramethylborolan-1-yl)aniline.
| Compound Name | 4-(4-aminophenyl)-2H-pyrazolo[3,4-b]pyridin-3-amine;ethane;4-(3,3,4,4-tetramethylborolan-1-yl)aniline |
|---|---|
| PubChem CID | 143263195 |
| Molecular Formula | C28H39BN6 |
| Molecular Weight | 470.47 g/mol |
| Exact Mass | 470.33 |
| IUPAC Name | 4-(4-aminophenyl)-2H-pyrazolo[3,4-b]pyridin-3-amine;ethane;4-(3,3,4,4-tetramethylborolan-1-yl)aniline |
| SMILES | CC.CC1(C)CB(c2ccc(N)cc2)CC1(C)C.Nc1ccc(-c2ccnc3n[nH]c(N)c23)cc1 |
| InChI | InChI=1S/C14H22BN.C12H11N5.C2H6/c1-13(2)9-15(10-14(13,3)4)11-5-7-12(16)8-6-11;13-8-3-1-7(2-4-8)9-5-6-15-12-10(9)11(14)16-17-12;1-2/h5-8H,9-10,16H2,1-4H3;1-6H,13H2,(H3,14,15,16,17);1-2H3 |
| InChIKey | AMADCQJZCHPXJK-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 119.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.47 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|