About (1Z)-4-hydroxy-1-methoxy-2-methylpenta-1,4-dien-3-one
(1Z)-4-hydroxy-1-methoxy-2-methylpenta-1,4-dien-3-one (PubChem CID 143263207) has the molecular formula C7H10O3
and a molecular weight of 142.15 g/mol. Its IUPAC name is (1Z)-4-hydroxy-1-methoxy-2-methylpenta-1,4-dien-3-one.
Molecular Properties
| Compound Name | (1Z)-4-hydroxy-1-methoxy-2-methylpenta-1,4-dien-3-one |
| PubChem CID | 143263207 |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | (1Z)-4-hydroxy-1-methoxy-2-methylpenta-1,4-dien-3-one |
| SMILES | C=C(O)C(=O)/C(C)=C\OC |
| InChI | InChI=1S/C7H10O3/c1-5(4-10-3)7(9)6(2)8/h4,8H,2H2,1,3H3/b5-4- |
| InChIKey | NDWWKWQARQZENX-PLNGDYQASA-N |
| XLogP | 1.18 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-4-hydroxy-1-methoxy-2-methylpenta-1,4-dien-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-4-hydroxy-1-methoxy-2-methylpenta-1,4-dien-3-one?
The IUPAC name of (1Z)-4-hydroxy-1-methoxy-2-methylpenta-1,4-dien-3-one (CID 143263207) is (1Z)-4-hydroxy-1-methoxy-2-methylpenta-1,4-dien-3-one.
What is the SMILES notation for (1Z)-4-hydroxy-1-methoxy-2-methylpenta-1,4-dien-3-one?
The canonical SMILES for (1Z)-4-hydroxy-1-methoxy-2-methylpenta-1,4-dien-3-one is C=C(O)C(=O)/C(C)=C\OC.
What is the InChIKey of (1Z)-4-hydroxy-1-methoxy-2-methylpenta-1,4-dien-3-one?
The InChIKey is NDWWKWQARQZENX-PLNGDYQASA-N. The full InChI is InChI=1S/C7H10O3/c1-5(4-10-3)7(9)6(2)8/h4,8H,2H2,1,3H3/b5-4-.
What are the key properties of (1Z)-4-hydroxy-1-methoxy-2-methylpenta-1,4-dien-3-one?
(1Z)-4-hydroxy-1-methoxy-2-methylpenta-1,4-dien-3-one has a molecular weight of 142.15 g/mol, XLogP of 1.18, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-4-hydroxy-1-methoxy-2-methylpenta-1,4-dien-3-one is sourced from PubChem (CID 143263207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).