C16H30N2O — CID 143263226
N-[(5,6-dimethyl-3-pyridinyl)methyl]-2-propoxyethanamine;propane (PubChem CID 143263226) has the molecular formula C16H30N2O and a molecular weight of 266.43 g/mol. Its IUPAC name is N-[(5,6-dimethyl-3-pyridinyl)methyl]-2-propoxyethanamine;propane.
| Compound Name | N-[(5,6-dimethyl-3-pyridinyl)methyl]-2-propoxyethanamine;propane |
|---|---|
| PubChem CID | 143263226 |
| Molecular Formula | C16H30N2O |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | N-[(5,6-dimethyl-3-pyridinyl)methyl]-2-propoxyethanamine;propane |
| SMILES | CCC.CCCOCCNCc1cnc(C)c(C)c1 |
| InChI | InChI=1S/C13H22N2O.C3H8/c1-4-6-16-7-5-14-9-13-8-11(2)12(3)15-10-13;1-3-2/h8,10,14H,4-7,9H2,1-3H3;3H2,1-2H3 |
| InChIKey | YJEJPFYAMFXPKY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|