C18H14F2N4O3 — CID 143263580
4-[(2-fluoro-3-methoxybenzoyl)amino]-N-(4-fluorophenyl)pyrazole-1-carboxamide (PubChem CID 143263580) has the molecular formula C18H14F2N4O3 and a molecular weight of 372.33 g/mol. Its IUPAC name is 4-[(2-fluoro-3-methoxybenzoyl)amino]-N-(4-fluorophenyl)pyrazole-1-carboxamide.
| Compound Name | 4-[(2-fluoro-3-methoxybenzoyl)amino]-N-(4-fluorophenyl)pyrazole-1-carboxamide |
|---|---|
| PubChem CID | 143263580 |
| Molecular Formula | C18H14F2N4O3 |
| Molecular Weight | 372.33 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 4-[(2-fluoro-3-methoxybenzoyl)amino]-N-(4-fluorophenyl)pyrazole-1-carboxamide |
| SMILES | COc1cccc(C(=O)Nc2cnn(C(=O)Nc3ccc(F)cc3)c2)c1F |
| InChI | InChI=1S/C18H14F2N4O3/c1-27-15-4-2-3-14(16(15)20)17(25)22-13-9-21-24(10-13)18(26)23-12-7-5-11(19)6-8-12/h2-10H,1H3,(H,22,25)(H,23,26) |
| InChIKey | DEOKJRKVTKEAGF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |