C12H16F2N2O2 — CID 143264073
(2Z,3E,5E)-2-(dimethylaminomethylidene)-4,5-difluoro-N-formyl-N-methylhepta-3,5-dienamide (PubChem CID 143264073) has the molecular formula C12H16F2N2O2 and a molecular weight of 258.27 g/mol. Its IUPAC name is (2Z,3E,5E)-2-(dimethylaminomethylidene)-4,5-difluoro-N-formyl-N-methylhepta-3,5-dienamide.
| Compound Name | (2Z,3E,5E)-2-(dimethylaminomethylidene)-4,5-difluoro-N-formyl-N-methylhepta-3,5-dienamide |
|---|---|
| PubChem CID | 143264073 |
| Molecular Formula | C12H16F2N2O2 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | (2Z,3E,5E)-2-(dimethylaminomethylidene)-4,5-difluoro-N-formyl-N-methylhepta-3,5-dienamide |
| SMILES | C/C=C(F)\C(F)=C/C(=C/N(C)C)C(=O)N(C)C=O |
| InChI | InChI=1S/C12H16F2N2O2/c1-5-10(13)11(14)6-9(7-15(2)3)12(18)16(4)8-17/h5-8H,1-4H3/b9-7-,10-5+,11-6+ |
| InChIKey | MUGFEVCGADHHFC-FQUBDNGYSA-N |
| XLogP | 1.77 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|