C26H25ClF3N3O — CID 143264518
(2E,4E)-N-(4-chloro-3-quinoxalin-2-ylphenyl)-6,6,6-trifluoro-5-methyl-2-prop-1-en-2-ylhexa-2,4-dienamide;ethane (PubChem CID 143264518) has the molecular formula C26H25ClF3N3O and a molecular weight of 487.95 g/mol. Its IUPAC name is (2E,4E)-N-(4-chloro-3-quinoxalin-2-ylphenyl)-6,6,6-trifluoro-5-methyl-2-prop-1-en-2-ylhexa-2,4-dienamide;ethane.
| Compound Name | (2E,4E)-N-(4-chloro-3-quinoxalin-2-ylphenyl)-6,6,6-trifluoro-5-methyl-2-prop-1-en-2-ylhexa-2,4-dienamide;ethane |
|---|---|
| PubChem CID | 143264518 |
| Molecular Formula | C26H25ClF3N3O |
| Molecular Weight | 487.95 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | (2E,4E)-N-(4-chloro-3-quinoxalin-2-ylphenyl)-6,6,6-trifluoro-5-methyl-2-prop-1-en-2-ylhexa-2,4-dienamide;ethane |
| SMILES | C=C(C)/C(=C\C=C(/C)C(F)(F)F)C(=O)Nc1ccc(Cl)c(-c2cnc3ccccc3n2)c1.CC |
| InChI | InChI=1S/C24H19ClF3N3O.C2H6/c1-14(2)17(10-8-15(3)24(26,27)28)23(32)30-16-9-11-19(25)18(12-16)22-13-29-20-6-4-5-7-21(20)31-22;1-2/h4-13H,1H2,2-3H3,(H,30,32);1-2H3/b15-8+,17-10+; |
| InChIKey | DWMUXJRMWSCRJX-LSVJCGQKSA-N |
| XLogP | 7.93 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.95 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|