C34H41FN4O2 — CID 143264723
(E)-2-[4-(3-aminopyrrolidin-1-yl)-5-fluoro-2-methyl-3-[(3-methylnaphthalen-2-yl)methyl]benzoyl]-N-(2-pyrrolidin-1-ylethyl)but-2-enamide (PubChem CID 143264723) has the molecular formula C34H41FN4O2 and a molecular weight of 556.73 g/mol. Its IUPAC name is (E)-2-[4-(3-aminopyrrolidin-1-yl)-5-fluoro-2-methyl-3-[(3-methylnaphthalen-2-yl)methyl]benzoyl]-N-(2-pyrrolidin-1-ylethyl)but-2-enamide.
| Compound Name | (E)-2-[4-(3-aminopyrrolidin-1-yl)-5-fluoro-2-methyl-3-[(3-methylnaphthalen-2-yl)methyl]benzoyl]-N-(2-pyrrolidin-1-ylethyl)but-2-enamide |
|---|---|
| PubChem CID | 143264723 |
| Molecular Formula | C34H41FN4O2 |
| Molecular Weight | 556.73 g/mol |
| Exact Mass | 556.32 |
| IUPAC Name | (E)-2-[4-(3-aminopyrrolidin-1-yl)-5-fluoro-2-methyl-3-[(3-methylnaphthalen-2-yl)methyl]benzoyl]-N-(2-pyrrolidin-1-ylethyl)but-2-enamide |
| SMILES | C/C=C(/C(=O)NCCN1CCCC1)C(=O)c1cc(F)c(N2CCC(N)C2)c(Cc2cc3ccccc3cc2C)c1C |
| InChI | InChI=1S/C34H41FN4O2/c1-4-28(34(41)37-12-16-38-13-7-8-14-38)33(40)30-20-31(35)32(39-15-11-27(36)21-39)29(23(30)3)19-26-18-25-10-6-5-9-24(25)17-22(26)2/h4-6,9-10,17-18,20,27H,7-8,11-16,19,21,36H2,1-3H3,(H,37,41)/b28-4+ |
| InChIKey | VXMNLMNIKXDBTL-KLCRIKRISA-N |
| XLogP | 5.06 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.73 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|